Details of SAPdb ID 1226 |
Primary information | ||
---|---|---|
SAPdb_ID | 1226 | |
PMID | 25384556 | |
Year | 2015 | |
Name | Compound A | |
Sequence | KK | |
N-Terminal Modification | Acetylation | |
C-Terminal Modification | Amidation | |
Non-terminal Modication | None | |
Length | 2 | |
Peptide/Conjugate/Mixture | Conjugate | |
Conjugate Partner | Camptothecin (CPT) -conjugated | |
Technique | Transmission Electron Microscopy (TEM) | |
Solvent | Phosphate buffer saline | |
Method | Samples were prepared by dissolving CPT–dipeptides in PBS (10 mm), then diluting to 1 mm after 24 h. | |
Concentration | 1mM | |
pH | 7.4 | |
Temperature | 37 °C | |
Incubation Period | 72 hours | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Coiled ribbon and tapes | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | CC(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N |