Details of SAPdb ID 1182 |
Primary information | ||
---|---|---|
SAPdb_ID | 1182 | |
PMID | 22543454 | |
Year | 2012 | |
Name | Tripeptide 3 | |
Sequence | KKK | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Transmission Electron Microscopy (TEM), AFM (Atomic Force Microscopy) | |
Solvent | Water | |
Method | A drop of aqueous solution (0.01 %) of eptide was placed on a carbon-coated copper grid and allowing the solution to evaporate under ambient conditions. | |
Concentration | 200 μM | |
pH | NA | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Nanosphere | |
Size of Self-Assembled structure | Radius: 40nm | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | NA | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC[NH3])C=O |