Details of SAPdb ID 1161 |
Primary information | ||
---|---|---|
SAPdb_ID | 1161 | |
PMID | 22016623 | |
Year | 2011 | |
Name | Ac-ID3 | |
Sequence | IVD | |
N-Terminal Modification | Acetylation | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | FE - SEM (Field Emission Scanning Electron Microscopy) | |
Solvent | Water | |
Method | Peptide dissolved in water by vortexing and left at room temperature to form hydrogel. Depending upon peptide concentration and sequence peptide form gel within minutes, hours or days. | |
Concentration | 2mg/ml | |
pH | NA | |
Temperature | Room temperature | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Membrane structure | |
Size of Self-Assembled structure | NA | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | Unstable | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | CC(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C=O |