Welcome to Entry Card of Peptide
Details of SAPdb ID 1155 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1155 | |
| PMID | 26631316 | |
| Year | 2015 | |
| Name | W1b (Linear Tri-Trp) | |
| Sequence | WWW | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 3 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | Scanning Electron Microscopy (SEM), Transmission Electron Microscopy (TEM) and AFM (Atomic Force Microscopy) | |
| Solvent | Methanol:chloroform (1:1) | |
| Method | NA | |
| Concentration | 2.54mM | |
| pH | NA | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Spherical structure | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C=O | |