Details of SAPdb ID 1118 |
Primary information | ||
---|---|---|
SAPdb_ID | 1118 | |
PMID | 16029045 | |
Year | 2005 | |
Name | Glutathione | |
Sequence | ECG | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Conjugate | |
Conjugate Partner | Conjugated with pyrene | |
Technique | Transmission Electron Microscopy (TEM), Scanning Electron Microscopy (SEM) and CD (Circular Dichroism spectroscopy) | |
Solvent | 95%water+ 5% DMSO | |
Method | Addition of water to peptide-conjuagate stock solution in DMSO in ratio (5:95) at final conc 1-10mM. It immediately generate transparent and flourescent gel. | |
Concentration | 10mM | |
pH | NA | |
Temperature | NA | |
Incubation Period | NA | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Transparent gel | |
Size of Self-Assembled structure | Diameter: 50-100nm | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | Stable | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](CCC(=O)O)C(=O)N[C@@H](CS)C(=O)NCC=O |