Details of SAPdb ID 1100 |
Primary information | ||
---|---|---|
SAPdb_ID | 1100 | |
PMID | 26014441 | |
Year | 2015 | |
Name | Peptide 2a | |
Sequence | DFF | |
N-Terminal Modification | Free | |
C-Terminal Modification | Amidation | |
Non-terminal Modication | None | |
Length | 3 | |
Peptide/Conjugate/Mixture | Peptide | |
Conjugate Partner | None | |
Technique | Transmission Electron Microscopy (TEM), FTIR and DOSY NMR | |
Solvent | Sodium phosphate buffer (100mM ) | |
Method | 20 mM of aspartame (DF-OMe) and 40 mM of the amino acid amide (Phe-NH2) were dissolved in 1 ml of 100mM sodium phosphate buffer pH 8 in the presence of 1 mg of chymotrypsin. The mixture was gently vortexed for 30s and sonicated for 60s in order to obtain a homogenous solution. gealtion was observed. | |
Concentration | NA | |
pH | 8 | |
Temperature | NA | |
Incubation Period | 8 hours | |
Self-Assembly Formation | Yes | |
Type of Self-Assembly | Spherical Nano structures | |
Size of Self-Assembled structure | Length :1-2 μm | |
Linear/Cyclic | Linear | |
Stability of Nanostructure | Stable | |
Comment | NA | |
Secondary information | ||
Physico-Chemical properties |
| |
STRUCTURE |
| |
SMILES | N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N |