Welcome to Entry Card of Peptide
Details of SAPdb ID 1022 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1022 | |
| PMID | 17328086 | |
| Year | 2007 | |
| Name | Zwitterionic dipeptide diPhenylalanine (l-Phe-l-Phe) | |
| Sequence | FF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | CD (Circular Dichroism spectroscopy) | |
| Solvent | Aqueous dispersion | |
| Method | Dipeptide could self-assemble into nanotubes at a concentration of 10 mg/mL | |
| Concentration | 10 mg/ml | |
| pH | 7.2 | |
| Temperature | Room temperature | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Nanotube | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |