Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence YLA |
| Primary information | |
|---|---|
| SAPdb ID | 1799, |
| PMID | 30892363 |
| Peptide Name | oligopeptide |
| Peptide sequence | YLA |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Solvent | sodium pHospHate buffer |
| Conc | 10mM |
| Temperature | 7 |
| Temperature | Room temperature |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | supramolecular complexes |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| supramolecular complexes | |
| NA | |
| None | |
| N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)O | |