Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence VI |
| Primary information | |
|---|---|
| SAPdb ID | 1943, |
| PMID | 28589640 |
| Peptide Name | Boc-Val-Ile-OMe |
| Peptide sequence | VI |
| N-Terminal Modification | Boc (or t-butoxycarbonyl) |
| C-Terminal Modification | Methoxy |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM, circular dichroism, attenuated total internal reflection-fourier transform infrared spectroscopy, X-ray diffraction and microscopy |
| Solvent | organic solvents |
| Conc | 6 mM |
| Temperature | Room temperature |
| Incubation Time | 30 min |
| Year | 2017 |
| Self assembly | Yes |
| Type of Self assembly | Nanotubes |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| NA | |
| VI | |
| N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)O | |