Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence SVA |
| Primary information | |
|---|---|
| SAPdb ID | 1771, |
| PMID | 31069301 |
| Peptide Name | Ac-SVA |
| Peptide sequence | SVA |
| N-Terminal Modification | Acetylation |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Technique | AFM, Bright field |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| None | |
| N[C@@]([H])(CO)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)O | |