Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence RFD |
| Primary information | |
|---|---|
| SAPdb ID | 1996, |
| PMID | 28836431 |
| Peptide Name | cyclic arginine-glycine-aspartic acid (cRGD) |
| Peptide sequence | RFD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | cryo-TEM |
| Solvent | deionised water |
| Conc | 0.1mM |
| Temperature | Room temperature |
| Incubation Time | 24 h |
| Year | 2017 |
| Self assembly | NA |
| Type of Self assembly | NA |
| Tertiary Structure (Technique) | Not Predicted), |
| NA | |
| NA | |
| NA | |
| NA | |
| NA | |
| None | |
| N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |