Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence PKK |
| Primary information | |
|---|---|
| SAPdb ID | 1971, |
| PMID | 28721731 |
| Peptide Name | poly-L-Lysine |
| Peptide sequence | PKK |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | SEM,TEM |
| Solvent | Na2B4O7-EDTA |
| Conc | 4 mg/mL |
| Temperature | 7.5 |
| Temperature | Room temperature |
| Incubation Time | 3 days |
| Year | 2017 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogels |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| None | |
| N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)O | |