Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence LLL |
| Primary information | |
|---|---|
| SAPdb ID | 1918, |
| PMID | 28440566 |
| Peptide Name | Boc-Leu-beta 3,3-Ac6c-Leu-beta 3,3 -Ac6c-Leu-OMe, P3 |
| Peptide sequence | LLL |
| N-Terminal Modification | Boc (or t-butoxycarbonyl) |
| C-Terminal Modification | Methoxy |
| Non-Terminal Modification | 1-Amino- cyclohexane acetic acid (beta3,3-Ac6c) |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Solvent | dioxane/water |
| Conc | 8:2 |
| Year | 2017 |
| Self assembly | No |
| Type of Self assembly | NA |
| Tertiary Structure (Technique) | Not Predicted), |
| NA | |
| NA | |
| NA | |
| NA | |
| NA | |
| LLL | |
| N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O | |