Details of SAPdb entry with Sequence IFD |
Primary information | |
---|---|
SAPdb ID | 1718, |
PMID | 30398280 |
Peptide Name | Ac-IFD-NH2 |
Peptide sequence | IFD |
N-Terminal Modification | Acetylation |
C-Terminal Modification | Amidation |
Non-Terminal Modification | None |
Length | 3 |
Peptide/Conjuagate | tripeptide |
Conjugate partner | None |
Technique | Transmission Electron Microscopy (TEM) |
Solvent | water of 0.87 wt% |
Conc | 20 mM |
Temperature | Room temperature |
Incubation Time | 2 h |
Year | 2018 |
Self assembly | Yes |
Type of Self assembly | nanostructures |
Tertiary Structure (Technique) | Not Predicted), |
Linear | |
NA | |
NA | |
Nanostructure | |
15-20 | |
None | |
N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |