Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence GY |
| Primary information | |
|---|---|
| SAPdb ID | 1392, |
| PMID | 24911955 |
| Peptide Name | PBI-[GY]2 |
| Peptide sequence | GY |
| N-Terminal Modification | Perylene bisimide |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Perylene bisimide |
| Technique | AFM (Atomic Force Microscopy) |
| Solvent | Aqeous buffer |
| Conc | 1 .5 x 10‚à Ã2 M |
| Temperature | 10.8 |
| Temperature | Room temperature |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Nanofibers |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofiber | |
| NA | |
| GY | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1393, |
| PMID | 24911955 |
| Peptide Name | PBI-[GY]2 |
| Peptide sequence | GY |
| N-Terminal Modification | Perylene bisimide |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Perylene bisimide |
| Technique | AFM (Atomic Force Microscopy) |
| Solvent | DMF |
| Conc | 5√ó 10‚à Ã3 M |
| Temperature | Room temperature |
| Year | 2014 |
| Self assembly | Yes |
| Type of Self assembly | Organogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Organogel | |
| NA | |
| GY | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1394, |
| PMID | 24911955 |
| Peptide Name | PBI-[GY]2 |
| Peptide sequence | GY |
| N-Terminal Modification | Perylene bisimide |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Perylene bisimide |
| Technique | AFM (Atomic Force Microscopy) |
| Solvent | DMSO |
| Conc | 5√ó 10‚à Ã3 M |
| Temperature | Room temperature |
| Year | 2014 |
| Self assembly | No |
| Type of Self assembly | No gel formation |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| GY | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1395, |
| PMID | 24911955 |
| Peptide Name | PBI-[GY]2 |
| Peptide sequence | GY |
| N-Terminal Modification | Perylene bisimide |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Perylene bisimide |
| Technique | AFM (Atomic Force Microscopy) |
| Solvent | Acetone |
| Conc | 5√ó 10‚à Ã3 M |
| Temperature | Room temperature |
| Year | 2014 |
| Self assembly | No |
| Type of Self assembly | No gel formation |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| GY | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1396, |
| PMID | 24911955 |
| Peptide Name | PBI-[GY]2 |
| Peptide sequence | GY |
| N-Terminal Modification | Perylene bisimide |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Perylene bisimide |
| Technique | AFM (Atomic Force Microscopy) |
| Solvent | THF |
| Conc | 5√ó 10‚à Ã3 M |
| Temperature | Room temperature |
| Year | 2014 |
| Self assembly | No |
| Type of Self assembly | No gel formation |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| None | |
| NA | |
| GY | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1651, |
| PMID | 29384183 |
| Peptide Name | perylene bisimide (PBI) |
| Peptide sequence | GY |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | conjugate |
| Conjugate partner | PBI-[GY]2 |
| Technique | Transmission Electron Microscopy (TEM) |
| Solvent | PBS buffer solution |
| Conc | 0.019 mM |
| Temperature | 27.7°C |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | nanofibers and nanospHeres |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofiber | |
| 20 | |
| GY | |
| NCC(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1786, |
| PMID | 30348428 |
| Peptide Name | Gly-L-Tyr |
| Peptide sequence | GY |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | peptide |
| Conjugate partner | None |
| Temperature | 7.6 |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | nanotubes |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| NA | |
| GY | |
| NCC(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O | |