Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence GW |
| Primary information | |
|---|---|
| SAPdb ID | 1784, |
| PMID | 30348428 |
| Peptide Name | Gly-L-Trp, |
| Peptide sequence | GW |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | peptide |
| Conjugate partner | None |
| Temperature | 7.6 |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | nanotubes |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| NA | |
| GW | |
| NCC(=O)N[C@@]([H])(CC(=CN2)C1=C2C=CC=C1)C(=O)O | |