Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence FP |
| Primary information | |
|---|---|
| SAPdb ID | 1007, |
| PMID | 18052148 |
| Peptide Name | Compound 1 |
| Peptide sequence | FP |
| N-Terminal Modification | Chlorination |
| C-Terminal Modification | N-hexadecylamine |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Field Emission Scanning Electron Microscopy (FE - SEM) |
| Solvent | Aqueous dispersion |
| Method | The aqueous dispersions of the required amount of compound was slowly heated to dissolve the compounds in water and then allowed to cool slowly (undisturbed) to room temperature in a vial. |
| Conc | Minimum gelation concentration=12% (w/v) |
| Temperature | 7 |
| Temperature | Room temperature |
| Incubation Time | 20-30 minutes |
| Year | 2007 |
| Self assembly | Yes |
| Type of Self assembly | opaque hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable-to-inversion of the container | |
| Hydrogel | |
| NA | |
| FP | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1270, |
| PMID | 19705843 |
| Peptide Name | Fmoc-FP |
| Peptide sequence | FP |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Transmission Electron Microscopy (TEM), AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide first dissolved in DMSO and then diluted in water to their final concentration 5mg/ml. Self assembled structure formed at room temperature |
| Conc | 5mg/ml |
| Temperature | 3 - 12 |
| Temperature | Room temperature |
| Year | 2009 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel (Nanosphere) |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| 20 | |
| FP | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1785, |
| PMID | 30348428 |
| Peptide Name | L-Phe-L-Pro |
| Peptide sequence | FP |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | peptide |
| Conjugate partner | None |
| Temperature | 7.6 |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | nanotubes |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanotube | |
| NA | |
| FP | |
| N[C@@]([H])(Cc1ccccc1)C(=O)N1[C@@]([H])(CCC1)C(=O)O | |