Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence FGD |
| Primary information | |
|---|---|
| SAPdb ID | 1927, |
| PMID | 28518205 |
| Peptide Name | FGD |
| Peptide sequence | FGD |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Transmission Electron Microscopy (TEM) |
| Method | NMR, HPLC, and ESI-MS |
| Conc | 20 mM |
| Temperature | Room temperature |
| Incubation Time | 24 h |
| Year | 2017 |
| Self assembly | Yes |
| Type of Self assembly | Sol (Spherical aggregates) |
| Tertiary Structure (Technique) | Not Predicted), |
| Cyclic | |
| NA | |
| NA | |
| Nanosphere | |
| 02-Apr | |
| None | |
| N[C@@]([H])(Cc1ccccc1)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)O | |