Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence FFS |
| Primary information | |
|---|---|
| SAPdb ID | 1174, |
| PMID | 23240879 |
| Peptide Name | Nap-FFS |
| Peptide sequence | FFS |
| N-Terminal Modification | Napthalene |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | Cryo - Transmission Electron Microscopy (TEM) |
| Solvent | PBS (Phosphate Buffer Saline) |
| Method | 1.0 mg of each peptide and equal molar of sodium carbonate to the peptide were first suspended in PBS buffer (pH = 7.4); the sodium carbonate was used to neutralize the terminal carboxylic acid of peptides. The suspensions were then heated to 80°C to form clear solutions. The gels would form after cooling back to room temperature within 3 min. |
| Conc | < 4% wt |
| Temperature | 7.4 |
| Temperature | Heating at 80 ℃, cooling at RT |
| Incubation Time | 3 minutes |
| Year | 2012 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| None | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1732, |
| PMID | 30452865 |
| Peptide Name | Fmoc-FFS |
| Peptide sequence | FFS |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | tripeptide |
| Conjugate partner | None |
| Technique | Scanning electron microscopy (SEM), atomic force microscopy (AFM) and transmission electron microscopy (TEM) |
| Conc | 2 mM |
| Temperature | 6 |
| Temperature | Room temperature |
| Incubation Time | 24 h |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | nanofibril |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanofiber | |
| NA | |
| None | |
| N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CO)C(=O)O | |
| Primary information | |
| SAPdb ID | 1975, |
| PMID | 28767108 |
| Peptide Name | ferrocene-Phenylalanine-Phenylalanine-serine (Fc-FFS) |
| Peptide sequence | FFS |
| N-Terminal Modification | Ferrocene (FC) |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 3 |
| Peptide/Conjuagate | Peptide |
| Conjugate partner | None |
| Technique | confocal laser scanning microscopy (CLSM), scanning electron microscopy (SEM), transmission electron microscopy (TEM), and atomic force microscope (AFM) |
| Solvent | phosphate buffer |
| Conc | 50 mM |
| Temperature | 7.2 |
| Temperature | 60 °C |
| Incubation Time | 30 s |
| Year | 2017 |
| Self assembly | Yes |
| Type of Self assembly | Nanovesicles |
| Tertiary Structure (Technique) | Not Predicted), |
| Cyclic | |
| NA | |
| NA | |
| Nanovesicle | |
| 498 | |
| None | |
| N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CO)C(=O)O | |