Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence CF |
| Primary information | |
|---|---|
| SAPdb ID | 1468, |
| PMID | 26133754 |
| Peptide Name | Hyaluronic acid -cysteine-Phenylalanine or HA- CF |
| Peptide sequence | CF |
| N-Terminal Modification | Hyaluronic acid |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Hyaluronic acid |
| Technique | NMR |
| Solvent | 10mM PBS + 0.5% CB (cucurbit[8]uril) |
| Method | 20 mg of polysaccharide-cysphe(PS-CF) was dissolved in 1 ml of PBS (0.01M) by stirring for several hours until a viscous transparent solution formed. 5mg CB was added and the gels stirred (approximately 1 h) until homogeneously turbid and viscoelastic. |
| Conc | 0.01 |
| Temperature | Room temperature |
| Incubation Time | > 1 hour |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| CF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1469, |
| PMID | 26133754 |
| Peptide Name | Hyaluronic acid -cysteine-Phenylalanine or HA- CF |
| Peptide sequence | CF |
| N-Terminal Modification | Hyaluronic acid |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Hyaluronic acid |
| Technique | NMR |
| Solvent | 10mM PBS + 0.5% CB (cucurbit[8]uril) |
| Method | 20 mg of polysaccharide-cysphe(PS-CF) was dissolved in 1 ml of PBS (0.01M) by stirring for several hours until a viscous transparent solution formed. 5mg CB was added and the gels stirred (approximately 1 h) until homogeneously turbid and viscoelastic. |
| Conc | 0.02 |
| Temperature | Room temperature |
| Incubation Time | > 1 hour |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| CF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1470, |
| PMID | 26133754 |
| Peptide Name | Carboxymethyl cellulose-cysteine-Phenylalanine or CMC-CF |
| Peptide sequence | CF |
| N-Terminal Modification | Carboxymethyl cellulose |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Carboxymethyl cellulose |
| Technique | NMR |
| Solvent | 10mM PBS + 0.5% CB (cucurbit[8]uril) |
| Method | 20 mg of polysaccharide-cysphe(PS-CF) was dissolved in 1 ml of PBS (0.01M) by stirring for several hours until a viscous transparent solution formed. 5mg CB was added and the gels stirred (approximately 1 h) until homogeneously turbid and viscoelastic. |
| Conc | 0.01 |
| Temperature | Room temperature |
| Incubation Time | > 1 hour |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| CF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1471, |
| PMID | 26133754 |
| Peptide Name | Carboxymethyl cellulose-cysteine-Phenylalanine or CMC-CF |
| Peptide sequence | CF |
| N-Terminal Modification | Carboxymethyl cellulose |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Carboxymethyl cellulose |
| Technique | NMR |
| Solvent | 10mM PBS + 0.5% CB (cucurbit[8]uril) |
| Method | 20 mg of polysaccharide-cysphe(PS-CF) was dissolved in 1 ml of PBS (0.01M) by stirring for several hours until a viscous transparent solution formed. 5mg CB was added and the gels stirred (approximately 1 h) until homogeneously turbid and viscoelastic. |
| Conc | 0.02 |
| Temperature | Room temperature |
| Incubation Time | > 1 hour |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Hydrogel | |
| NA | |
| CF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1472, |
| PMID | 26133754 |
| Peptide Name | Hydroxyethyl cellulose-cysteine-Phenylalanine or HEC-CF |
| Peptide sequence | CF |
| N-Terminal Modification | Hydroxyethyl cellulose |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Hydroxyethyl cellulose |
| Technique | NMR |
| Solvent | 10mM PBS + 0.5% CB (cucurbit[8]uril) |
| Method | 20 mg of polysaccharide-cysphe(PS-CF) was dissolved in 1 ml of PBS (0.01M) by stirring for several hours until a viscous transparent solution formed. 5mg CB was added and the gels stirred (approximately 1 h) until homogeneously turbid and viscoelastic. |
| Conc | 0.01 |
| Temperature | Room temperature |
| Incubation Time | > 1 hour |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Unstable | |
| Hydrogel | |
| NA | |
| CF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1473, |
| PMID | 26133754 |
| Peptide Name | Hydroxyethyl cellulose-cysteine-Phenylalanine or HEC-CF |
| Peptide sequence | CF |
| N-Terminal Modification | Hydroxyethyl cellulose |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | Conjugate |
| Conjugate partner | Hydroxyethyl cellulose |
| Technique | NMR |
| Solvent | 10mM PBS + 0.5% CB (cucurbit[8]uril) |
| Method | 20 mg of polysaccharide-cysphe(PS-CF) was dissolved in 1 ml of PBS (0.01M) by stirring for several hours until a viscous transparent solution formed. 5mg CB was added and the gels stirred (approximately 1 h) until homogeneously turbid and viscoelastic. |
| Conc | 0.02 |
| Temperature | Room temperature |
| Incubation Time | > 1 hour |
| Year | 2015 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Unstable | |
| Hydrogel | |
| NA | |
| CF | |
| N.A. | |
| Primary information | |
| SAPdb ID | 1710, |
| PMID | 30307451 |
| Peptide Name | Fmoc-CF |
| Peptide sequence | CF |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | peptide |
| Conjugate partner | None |
| Technique | UV-vis spectroscopy and BAM |
| Solvent | air/water |
| Temperature | 7 |
| Temperature | Room temperature |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | nanostructures |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanostructure | |
| NA | |
| CF | |
| N[C@@]([H])(CS)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |
| Primary information | |
| SAPdb ID | 1762, |
| PMID | 30950622 |
| Peptide Name | Fmoc-CF |
| Peptide sequence | CF |
| N-Terminal Modification | Fmoc [or N-(fluorenyl-9-methoxycarbonyl)] |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | peptide |
| Conjugate partner | None |
| Technique | UV−Vis Reflection Spectroscopy and Brewster Angle Microscopy |
| Solvent | dichloromethane |
| Conc | 1mM |
| Temperature | 2 |
| Temperature | 21 °C |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | nanomaterials |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Nanostructure | |
| NA | |
| CF | |
| N[C@@]([H])(CS)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O | |