Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence CDP |
| Primary information | |
|---|---|
| SAPdb ID | 1704, |
| PMID | 30175529 |
| Peptide Name | Dipenylalanine cationic peptide |
| Peptide sequence | CDP |
| N-Terminal Modification | Free |
| C-Terminal Modification | Amidation |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | peptide |
| Conjugate partner | None |
| Technique | (FTIR) and (ESI MS) |
| Solvent | 1,1,1,3,3,3-hexafluoro-2-propanol (HFP) |
| Method | In the process of peptide (CDP, H-pHe-pHe-NH2∙HCl) self- assembly, glutaraldehyde (GA) was used as a cross-linker and the resulting product due to the Schiff base reaction can be fluorescent. |
| Conc | 200 μL |
| Temperature | 50°C |
| Incubation Time | 4 h, 24 h, or 72 h |
| Year | 2019 |
| Self assembly | Yes |
| Type of Self assembly | spherical nanoparticles |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| Stable | |
| Other | |
| NA | |
| None | |
| N[C@@]([H])(CS)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)O | |