| ID | 2098 |
| Name | Erysonine |
| Pubchem ID | 442218 |
| KEGG ID | C09422 |
| Source | Erythrina melanacantha |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 285.34 |
| Exact mass | 285.136493 |
| Molecular formula | C17H19NO3 |
| XlogP | 1.3 |
| Topological Polar Surface Area | 52.9 |
| H-Bond Donor | 2 |
| H-Bond Acceptor | 4 |
| Rotational Bond Count | 1 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1=C(C=C2CCN3CC=C4C3(C2=C1)CC(C=C4)O)O |
| Isomeric SMILE | COC1=C(C=C2CCN3CC=C4[C@]3(C2=C1)C[C@H](C=C4)O)O |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |
| ID | 2134 |
| Name | Erythratidine |
| Pubchem ID | 442220 |
| KEGG ID | C09424 |
| Source | Erythrina melanacantha |
| Type | Natural |
| Function | Neuromuscular blocking agent |
| Drug Like Properties | Yes |
| Molecular Weight | 331.41 |
| Exact mass | 331.178358 |
| Molecular formula | C19H25NO4 |
| XlogP | 1.2 |
| Topological Polar Surface Area | 51.2 |
| H-Bond Donor | 1 |
| H-Bond Acceptor | 5 |
| Rotational Bond Count | 3 |
| IUPAC Name | N/A |
| Structure | |
| SDF file | |
| MOL file | |
| PDB file | |
| Canonical SMILE | COC1CC23C(=CC1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Isomeric SMILE | CO[C@@H]1C[C@@]23C(=C[C@@H]1O)CCN2CCC4=CC(=C(C=C34)OC)OC |
| Drugpedia | wiki |
| References | 1. Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter21 2. Source 3. Function 4. All Records |