Detailed description of 4275 ID |
Primary information | |||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|
AHTPDB ID | 4275 | ||||||||||||
PMID | 21773582 | ||||||||||||
YEAR | 2011 | ||||||||||||
SEQUENCE | TTMPLW | ||||||||||||
LENGTH | 6 | ||||||||||||
MOL WT | 747.91 | ||||||||||||
IC50 | ND | ||||||||||||
pIC50 | ND | ||||||||||||
SOURCE | Bovine casein proteins | ||||||||||||
TESTED ON | ND | ||||||||||||
PURIFICATION | ND | ||||||||||||
ASSAY | ND | ||||||||||||
BITTERNESS | ND | ||||||||||||
ISOELECTRIC POINT | 5.19 | ||||||||||||
SYSTOLIC BP DECREASE | ND | ||||||||||||
Secondary information | |||||||||||||
Properties | Physico-Chemical details | ||||||||||||
STRUCTURE |
| ||||||||||||
DSSP states | CCCCCC | ||||||||||||
SMILES | N[C@@H]([C@@H](C)O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCSC)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]c(C)c1CC)C(=O)O | ||||||||||||
External Links to PDB, Swiss-Prot and IEDB | |||||||||||||
| |||||||||||||
Reference Informaiton | |||||||||||||
ARTICLE/REFERENCE | Bioactive peptides derived from milk proteins and their health beneficial potentials: an update. | ||||||||||||
AUTHORS/PRIMARY REFERENCE | Nagpal R1, Behare P, Rana R, Kumar A, Kumar M, Arora S, Morotta F, Jain S, Yadav H. | ||||||||||||
JOURNAL/EXTRA LINKS | Food Funct. 2011 Jan;2(1):18-27. |