Detailed description of 4271 ID |
Primary information | |||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|
AHTPDB ID | 4271 | ||||||||||||
PMID | 21773582 | ||||||||||||
YEAR | 2011 | ||||||||||||
SEQUENCE | KVLPVPQ | ||||||||||||
LENGTH | 7 | ||||||||||||
MOL WT | 779.98 | ||||||||||||
IC50 | ND | ||||||||||||
pIC50 | ND | ||||||||||||
SOURCE | Bovine casein proteins | ||||||||||||
TESTED ON | ND | ||||||||||||
PURIFICATION | ND | ||||||||||||
ASSAY | ND | ||||||||||||
BITTERNESS | ND | ||||||||||||
ISOELECTRIC POINT | 8.75 | ||||||||||||
SYSTOLIC BP DECREASE | ND | ||||||||||||
Secondary information | |||||||||||||
Properties | Physico-Chemical details | ||||||||||||
STRUCTURE |
| ||||||||||||
DSSP states | CCSSSCC | ||||||||||||
SMILES | N[C@@H](CCCCN)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(=O)N)C(=O)O | ||||||||||||
External Links to PDB, Swiss-Prot and IEDB | |||||||||||||
| |||||||||||||
Reference Informaiton | |||||||||||||
ARTICLE/REFERENCE | Bioactive peptides derived from milk proteins and their health beneficial potentials: an update. | ||||||||||||
AUTHORS/PRIMARY REFERENCE | Nagpal R1, Behare P, Rana R, Kumar A, Kumar M, Arora S, Morotta F, Jain S, Yadav H. | ||||||||||||
JOURNAL/EXTRA LINKS | Food Funct. 2011 Jan;2(1):18-27. |