ID | 1151 | |
PMID | 16113599 | |
Year | 2007 | |
Sequence | SIINFEKL | |
Name | OVA257–264 | |
Length | 8 | |
N-Terminal Modification | Free | |
C-Terminal Modification | Free | |
Linear/ Cyclic | Linear | |
Chirality | L | |
Chemical Modification | None | |
Origin of Peptide | Synthetic | |
Nature of Peptide/Cargo | It is a class I (Kb)-restricted peptide epitope of ovalbumin (OVA), presented by the class I major histocompatibility complex (MHC) molecule, H-2Kb. | |
Mechanism | It has been demonstrated that OVA 257-264 peptides can be used to detect a strong CD8+ cytolytic T cell response. | |
Cargo Sequence/Structure | PBS with 15% DMSO | |
Name of cargo | Vehicle | |
Assay | ELISPOT assay | |
Enhancer | 37°C for 24 hours during the assay, dose applied once and tested after 7 days | |
Properties of enhancer | Not applicable | |
Concentration | 300 μmol peptide(10 mg/mL stock)+35µl vehicle | |
Incubation time | 7 days | |
Tissue permeability (value with units) | ~ 65 spots/1*106 total cells | |
Tissue Sample | Epidermal layer of naive C57BL mice | |
Ex vivo/In vivo/In vitro | ex vivo | |
STRUCTURE |
| |
SMILES | N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N [C@@H](CC(=O)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(=O)O)C(=O) N[C@@H](CCCC[NH3])C(=O)N[C@@H](CC(C)C)C=O |