| ID | 1104 | |
| PMID | 21220538 | |
| Year | 2011 | |
| Sequence | KWLNALLHHGLNCAK GVLA | |
| Name | HG1 | |
| Length | 19 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Amidation | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Derived from a natural AMP (halocidin) detected in the hemocytes of a tunicate, Halocynthia aurantium | |
| Nature of Peptide/Cargo | Antimicrobial | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Confocal microscopy, HPLC | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | 20µl of 5% (w/v) HG1 solution | |
| Incubation time | 12 hours | |
| Tissue permeability (value with units) | Significant permeability of the peptide can be seen in confocal images | |
| Tissue Sample | ICR mice skin | |
| Ex vivo/In vivo/In vitro | ex vivo | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CCCC[NH3])C(=O)N[C@@H](Cc1c[nH] c2ccccc12)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC (=O)N)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O) N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1nc[nH]c1)C(=O)N[C@@H] (CC1=CNCN1)C(=O)NCC(=O)N[C@@H](CC (C)C)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H] (CS)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCC[NH3]) C(=O)NCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H] (CC(C)C)C(=O)N[C@@H](C)C(=O)N | |