| ID | 1076 | |
| PMID | 22617521 | |
| Year | 2012 | |
| Sequence | RRRRRRRR | |
| Name | Polyarginine | |
| Length | 8 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | 6 histidine tag | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | De novo synthesis | |
| Nature of Peptide/Cargo | Cell penetrating peptide | |
| Mechanism | Polyarginines interacting with heparan sulphates that promote endocytosis | |
| Cargo Sequence/Structure | Not mentioned | |
| Name of cargo | Spantide II (SP) | |
| Assay | Franz cell system | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | 200µl of solution, NLC-R11(nanoparticle dispersion in water) formulation, containing 0.025% w/w SP (Spantide II) and 0.05% w/w KP (Ketoprofen) | |
| Incubation time | 24 h | |
| Tissue permeability (value with units) | The SC, epidermal and dermal retention of SP for SP-NLC-R11 was 10.92, 7.02 and 0.82 mg/g of skin, respectively and the SC, epidermal and dermal retention of KP for KP-NLC-R11 was 0.75, 0.44 and 0.17 mg/g of skin, respectively | |
| Tissue Sample | Skin from the dorsal surface of hairless rat | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2])N) C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2])N) C(=O)N[C@@H](CCCNC(=[NH2])N) C(=O)N[C@@H](CCCNC(=[NH2])N)CO | |