Welcome to Sequence Card of Peptide
Details of SAPdb entry with Sequence Gly-Tyr |
| Primary information | |
|---|---|
| SAPdb ID | 1701, |
| PMID | 30152598 |
| Peptide Name | Glycyl-L-tyrosine |
| Peptide sequence | Gly-Tyr |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-Terminal Modification | None |
| Length | 2 |
| Peptide/Conjuagate | peptide |
| Conjugate partner | None |
| Solvent | HRP |
| Conc | 13.2 μL |
| Temperature | 37 °C |
| Incubation Time | 4 h |
| Year | 2018 |
| Self assembly | Yes |
| Type of Self assembly | Hydrogel |
| Tertiary Structure (Technique) | Not Predicted), |
| Linear | |
| NA | |
| NA | |
| Hydrogel | |
| NA | |
| GY | |
| NCC(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O | |