Welcome to Entry Card of Peptide
Details of SAPdb ID 1701 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1701 | |
| PMID | 30152598 | |
| Year | 2018 | |
| Name | Glycyl-L-tyrosine | |
| Sequence | Gly-Tyr | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | peptide | |
| Conjugate Partner | None | |
| Technique | NA | |
| Solvent | HRP | |
| Method | NA | |
| Concentration | 13.2 μL | |
| pH | NA | |
| Temperature | 37 °C | |
| Incubation Period | 4 h | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Hydrogel | |
| Size of Self-Assembled structure | NA | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O | |