| Primary information |
|---|
| ID | 20751 |
| Pubchem ID | NA |
| Name | Prostaglandin J2 |
| Description | Prostaglandin J2 (PGJ2) is an endogenous product of inflammation in humans. It induces neuronal death and the accumulation of ubiquitinated proteins into distinct aggregates. It may play a role in neurodegenerative disorders inducing a chain of events that culminates in neuronal cell death. An alter |
| Synonym | 9-Deoxy-delta-9-PGD2ChEBI9-Deoxy-delta-9-prostaglandin D2ChEBIPGJ2ChEBI9-Deoxy-δ-9-PGD2Generator9-Deoxy-δ-9-prostaglandin D2Generator11-oxo-15S-Hydroxy-5Z;8Z;13E-prostatrienoate; 11-oxo-15S-Hydroxy-5Z |
| Molecular Weight | 334.4498 |
| Formula | NA |
| IUPAC | (5Z)-7-[(1S;5R)-5-[(1E;3S)-3-hydroxyoct-1-en-1-yl]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid |
| SMILE | CCCCC[C@H](O)C=C[C@@H]1[C@@H](CC=C/CCCC(O)=O)C=CC1=O |
| PDB ID | NA |
| KEGG | C05957 |
| HMDB ID | HMDB0002710 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|