Primary information |
---|
ID | 20748 |
Pubchem ID | NA |
Name | Deoxycorticosterone |
Description | 11-Deoxycorticosterone (also called desoxycortone; 21-hydroxyprogesterone; DOC; or simply deoxycorticosterone) is a steroid hormone produced by the adrenal gland that possesses mineralocorticoid activity and acts as a precursor to aldosterone. It is classified as a member of the 21-hydroxysteroids. |
Synonym | 21-Hydroxy-4-pregnene-3;20-dioneChEBI21-HydroxyprogesteroneChEBI4-Pregnen-21-ol-3;20-dioneChEBICortexoneChEBIDESOXYCORTICOSTERONEChEBIDesoxycortoneChEBIDOCChEBIKendall's desoxy compound bChEBIReichste |
Molecular Weight | 330.4611 |
Formula | NA |
IUPAC | (1S;2R;10S;11S;14S;15S)-14-(2-hydroxyacetyl)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-6-en-5-one |
SMILE | [H][C@@]12CC[C@H](C(=O)CO)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
PDB ID | NA |
KEGG | C03205 |
HMDB ID | HMDB0000016 |
Melting Point (Degree C) | 141 |
Water Solubility | 0.06 mg/mL at 37 °C |
Drugbank ID | NA |
Receptor | NA |
Reference | HMDB
|