| Primary information |
|---|
| ID | 20747 |
| Pubchem ID | NA |
| Name | Thyroxine |
| Description | Thyroxine or T4 is one of two major hormones derived from the thyroid gland; the other being triiodothyronine (T3). The major form of thyroid hormone in the blood is thyroxine (T4); which has a longer half-life than T3. In humans; the ratio of T4 to T3 released into the blood is approximately 14:1. |
| Synonym | 3;3';5;5'-Tetraiodo-L-thyronineChEBI3;5;3';5'-TETRAIODO-L-thyronineChEBI4-(4-Hydroxy-3;5-diiodophenoxy)-3;5-diiodo-L-phenylalanineChEBIL-T4ChEBILevothyroxinChEBILevothyroxineChEBILT4ChEBIO-(4-Hydroxy- |
| Molecular Weight | 776.87 |
| Formula | NA |
| IUPAC | (2S)-2-amino-3-[4-(4-hydroxy-3;5-diiodophenoxy)-3;5-diiodophenyl]propanoic acid |
| SMILE | N[C@@H](CC1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1)C(O)=O |
| PDB ID | NA |
| KEGG | C01829 |
| HMDB ID | HMDB0000248 |
| Melting Point (Degree C) | 235.5 |
| Water Solubility | NA |
| Drugbank ID | DB00451 |
| Receptor | NA |
| Reference | HMDB
|