Primary information |
---|
ID | 20746 |
Pubchem ID | NA |
Name | Liothyronine |
Description | Liothyronine is a T3 thyroid hormone normally synthesized and secreted by the thyroid gland in much smaller quantities than thyroxine (T4). Most T3 is derived from peripheral monodeiodination of T4 at the 5' position of the outer ring of the iodothyronine nucleus. The hormone that is finally deliver |
Synonym | 3;5;3'-Triiodo-L-thyronineChEBI3;5;3'-TriiodothyronineChEBI3;5;3'TRIIODOTHYRONINEChEBI4-(4-Hydroxy-3-iodophenoxy)-3;5-diiodo-L-phenylalanineChEBIL-3;5;3'-TriiodothyronineChEBIL-T3ChEBILiothyroninumChE |
Molecular Weight | 650.9735 |
Formula | NA |
IUPAC | (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3;5-diiodophenyl]propanoic acid |
SMILE | N[C@@H](CC1=CC(I)=C(OC2=CC(I)=C(O)C=C2)C(I)=C1)C(O)=O |
PDB ID | NA |
KEGG | C02465 |
HMDB ID | HMDB0000265 |
Melting Point (Degree C) | NA |
Water Solubility | NA |
Drugbank ID | DB00279 |
Receptor | NA |
Reference | HMDB
|