| Primary information |
|---|
| ID | 20744 |
| Pubchem ID | NA |
| Name | Norepinephrine |
| Description | Norepinephrine is the precursor of epinephrine that is secreted by the adrenal medulla and is a widespread central and autonomic neurotransmitter. Norepinephrine is the principal transmitter of most postganglionic sympathetic fibers and of the diffuse projection system in the brain arising from the |
| Synonym | (-)-ArterenolChEBI(-)-NoradrenalineChEBI(-)-NorepinephrineChEBI(R)-(-)-NorepinephrineChEBI(R)-4-(2-amino-1-Hydroxyethyl)-1;2-benzenediolChEBI(R)-NorepinephrineChEBI4-[(1R)-2-amino-1-Hydroxyethyl]-1;2- |
| Molecular Weight | 169.1778 |
| Formula | NA |
| IUPAC | 4-[(1R)-2-amino-1-hydroxyethyl]benzene-1;2-diol |
| SMILE | NC[C@H](O)C1=CC(O)=C(O)C=C1 |
| PDB ID | NA |
| KEGG | C00547 |
| HMDB ID | HMDB0000216 |
| Melting Point (Degree C) | 145.2 |
| Water Solubility | 849 mg/mL |
| Drugbank ID | DB00368 |
| Receptor | NA |
| Reference | HMDB
|