| Primary information |
|---|
| ID | 20743 |
| Pubchem ID | NA |
| Name | Melatonin |
| Description | Melatonin is a biogenic amine that is found in animals; plants and microbes. Aaron B. Lerner of Yale University is credited for naming the hormone and for defining its chemical structure in 1958. In mammals; melatonin is produced by the pineal gland. The pineal gland is small endocrine gland; about |
| Synonym | 5-Methoxy-N-acetyltryptamineChEBIMelatonineChEBIN-[2-(5-Methoxyindol-3-yl)ethyl]acetamideChEBIN-Acetyl-5-methoxytryptamineChEBIMelatoninaKeggCircadin; Melatol; Melatonin (synth.) standard-grade; Melat |
| Molecular Weight | 232.2783 |
| Formula | NA |
| IUPAC | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
| SMILE | COC1=CC2=C(NC=C2CCNC(C)=O)C=C1 |
| PDB ID | NA |
| KEGG | C01598 |
| HMDB ID | HMDB0001389 |
| Melting Point (Degree C) | 117 |
| Water Solubility | NA |
| Drugbank ID | DB01065 |
| Receptor | NA |
| Reference | HMDB
|