| Primary information |
|---|
| ID | 20739 |
| Pubchem ID | NA |
| Name | Epinephrine |
| Description | Epinephrine is a catecholamine; a sympathomimetic monoamine derived from the amino acids phenylalanine and tyrosine. It is the active sympathomimetic hormone secreted from the adrenal medulla in most species. It stimulates both the alpha- and beta- adrenergic systems; causes systemic vasoconstrictio |
| Synonym | (-)-(R)-EpinephrineChEBI(-)-3;4-Dihydroxy-alpha-((methylamino)methyl)benzyl alcoholChEBI(-)-AdrenalineChEBI(R)-(-)-AdrenalineChEBI(R)-(-)-AdnephrineChEBI(R)-(-)-EpinephrineChEBI(R)-(-)-EpirenamineChEB |
| Molecular Weight | 183.2044 |
| Formula | NA |
| IUPAC | 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1;2-diol |
| SMILE | CNC[C@H](O)C1=CC(O)=C(O)C=C1 |
| PDB ID | NA |
| KEGG | C00788 |
| HMDB ID | HMDB0000068 |
| Melting Point (Degree C) | 211.5 |
| Water Solubility | 0.18 mg/mL |
| Drugbank ID | DB00668 |
| Receptor | NA |
| Reference | HMDB
|