| Primary information |
|---|
| ID | 20736 |
| Pubchem ID | NA |
| Name | O-Arachidonoyl Ethanolamine |
| Description | Arachidonoyl ethanolamide (AEA) was the first endogenous cannabinoid to be isolated and characterized as an agonist acting on the same receptors (CB1 and CB2) as tetrahydrocannabinols (THC). |
| Synonym | Arachidonic acid-(2-aminoethyl)-ester; O-AEA; Virodhamine; O-Arachidonyl ethanol amineMeSH; HMDBO-Arachidonoyl ethanolamineMeSH |
| Molecular Weight | 347.5347 |
| Formula | NA |
| IUPAC | 2-aminoethyl (5Z;8Z;11Z;14Z)-icosa-5;8;11;14-tetraenoate |
| SMILE | CCCCCC=C/CC=C/CC=C/CC=C/CCCC(=O)OCCN |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0013655 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|