| Primary information |
|---|
| ID | 20735 |
| Pubchem ID | NA |
| Name | Thromboxane A2 |
| Description | Thromboxane A2 is an unstable intermediate between the prostaglandin endoperoxides and thromboxane B2. The compound has a bicyclic oxaneoxetane structure. It is a potent inducer of platelet aggregation and causes vasoconstriction. It is the principal component of rabbit aorta contracting substance ( |
| Synonym | (5Z;13E)-(15S)-9alpha;11alpha-Epoxy-15-hydroxythromboxa-5;13-dienoateChEBI(5Z;9alpha;11alpha;13E;15S)-9;11-Epoxy-15-hydroxythromboxa-5;13-dien-1-Oic acidChEBI9S;11S-Epoxy;15S-hydroxy-thromboxa-5Z;13E- |
| Molecular Weight | 352.4651 |
| Formula | NA |
| IUPAC | (5Z)-7-[(1S;3R;4S;5S)-3-[(1E;3S)-3-hydroxyoct-1-en-1-yl]-2;6-dioxabicyclo[3.1.1]heptan-4-yl]hept-5-enoic acid |
| SMILE | CCCCC[C@H](O)C=C[C@H]1O[C@H]2C[C@H](O2)[C@@H]1CC=C/CCCC(O)=O |
| PDB ID | NA |
| KEGG | C02198 |
| HMDB ID | HMDB0001452 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|