| Primary information |
|---|
| ID | 20733 |
| Pubchem ID | NA |
| Name | Resolvin E1 |
| Description | Resolvin E1 is a resolvin; a bioactive oxygenated product of EPA (eicosapentaenoic acid). It is a inflammation-resolving lipid mediator. RvE1 reduces neutrophil hyper-function; it also prevents the initiation and progression of tissue destruction |
| Synonym | 5S;12R;18R-Trihydroxy-6Z;8E;10E;14Z;16E-epa; ResolvinE1; RvE1; 5S;12R;18R-Trihydroxy-6Z;8E;10E;14Z;16E-eicosapentaenoic acid; (6Z;8E;10E;14Z;16E)-5;12;18-Trihydroxyicosa-6;8;10;14;16-pentaenoate; Reso |
| Molecular Weight | 350.4492 |
| Formula | NA |
| IUPAC | (6Z;8E;10E;14Z;16E)-5;12;18-trihydroxyicosa-6;8;10;14;16-pentaenoic acid |
| SMILE | CCC(O)C=CC=C/CC(O)C=CC=CC=C/C(O)CCCC(O)=O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0010410 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|