| Primary information |
|---|
| ID | 20732 |
| Pubchem ID | NA |
| Name | Prostaglandin I2 |
| Description | Prostaglandin I2 or prostacyclin (or PGI2) is a member of the family of lipid molecules known as eicosanoids. It is produced in endothelial cells from prostaglandin H2 (PGH2) by the action of the enzyme prostacyclin synthase. It is a powerful vasodilator and inhibits platelet aggregation. Prostaglan |
| Synonym | (5Z;13E)-(15S)-6;9alpha-Epoxy-11alpha;15-dihydroxyprosta-5;13-dienoateChEBI(5Z;9alpha;11alpha;13E;15S)-6;9-Epoxy-11;15-dihydroxyprosta-5;13-dien-1-Oic acidChEBIEpoprostenolChEBIFlolanChEBIPGI2ChEBIPGX |
| Molecular Weight | 352.4651 |
| Formula | NA |
| IUPAC | 5-[(3aR;4R;5R;6aS)-5-hydroxy-4-[(1E;3S)-3-hydroxyoct-1-en-1-yl]-hexahydro-2H-cyclopenta[b]furan-2-ylidene]pentanoic acid |
| SMILE | CCCCC[C@H](O)C=C[C@H]1[C@H](O)C[C@@H]2OC(C[C@H]12)=CCCCC(O)=O |
| PDB ID | NA |
| KEGG | C01312 |
| HMDB ID | HMDB0001335 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|