| Primary information |
|---|
| ID | 20730 |
| Pubchem ID | NA |
| Name | Prostaglandin E3 |
| Description | Prostaglandin E3 is from the cyclooxygenase metabolism of eicosapentaenoic acid.Prostaglandins are eicosanoids. The eicosanoids consist of the prostaglandins (PGs); thromboxanes (TXs); leukotrienes (LTs); and lipoxins (LXs). |
| Synonym | (5Z;11alpha;13E;15S;17Z)-11;15-Dihydroxy-9-oxoprosta-5;13;17-trien-1-Oic acidChEBI9-oxo-11R;15S-Dihydroxy-5Z;13E;17Z-prostatrienoic acidChEBIPGE3ChEBI(5Z;11a;13E;15S;17Z)-11;15-Dihydroxy-9-oxoprosta-5 |
| Molecular Weight | 350.4492 |
| Formula | NA |
| IUPAC | (5Z)-7-[(1R;2R;3R)-3-hydroxy-2-[(1E;3S;5Z)-3-hydroxyocta-1;5-dien-1-yl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILE | CCC=C/C[C@H](O)C=C[C@H]1[C@H](O)CC(=O)[C@@H]1CC=C/CCCC(O)=O |
| PDB ID | NA |
| KEGG | C06439 |
| HMDB ID | HMDB0002664 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|