| Primary information |
|---|
| ID | 20729 |
| Pubchem ID | NA |
| Name | Prostaglandin E2 |
| Description | The naturally occurring prostaglandin E2 (PGE2) is known in medicine as dinoprostone; and it is the most common and most biologically active of the mammalian prostaglandins. |
| Synonym | (15S)-Prostaglandin e2ChEBI(5Z;11alpha;13E;15S)-11;15-Dihydroxy-9-oxoprosta-5;13-dien-1-Oic acidChEBI(5Z;13E)-(15S)-11alpha;15-Dihydroxy-9-oxoprost-13-enoateChEBI(5Z;13E)-(15S)-11alpha;15-Dihydroxy-9- |
| Molecular Weight | 352.4651 |
| Formula | NA |
| IUPAC | (5Z)-7-[(1R;2R;3R)-3-hydroxy-2-[(1E;3S)-3-hydroxyoct-1-en-1-yl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILE | CCCCC[C@H](O)C=C[C@H]1[C@H](O)CC(=O)[C@@H]1CC=C/CCCC(O)=O |
| PDB ID | NA |
| KEGG | C00584 |
| HMDB ID | HMDB0001220 |
| Melting Point (Degree C) | 67 |
| Water Solubility | NA |
| Drugbank ID | DB00917 |
| Receptor | Q9Z2J6; P35375; P70597; Q9BGL8; P43116; Q62053; Q62928 |
| Reference | HMDB
|