| Primary information |
|---|
| ID | 20728 |
| Pubchem ID | NA |
| Name | Prostaglandin E1 |
| Description | Prostaglandin E1 (PGE1) is a potent endogenous vasodilator agent that increases peripheral blood flow. It inhibits platelet aggregation and has many other biological effects such as bronchodilation; mediation of inflammation; and various protective functions. |
| Synonym | (11alpha;13E;15S)-11;15-Dihydroxy-9-oxoprost-13-en-1-Oic acidChEBI(13E)-(15S)-11alpha;15-Dihydroxy-9-oxoprost-13-enoateChEBI11alpha;15alpha-Dihydroxy-9-oxo-13-trans-prostenoic acidChEBIAlprostadilChEB |
| Molecular Weight | 354.487 |
| Formula | NA |
| IUPAC | 7-[(1R;2R;3R)-3-hydroxy-2-[(1E;3S)-3-hydroxyoct-1-en-1-yl]-5-oxocyclopentyl]heptanoic acid |
| SMILE | CCCCC[C@H](O)C=C[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(O)=O |
| PDB ID | NA |
| KEGG | C04741 |
| HMDB ID | HMDB0001442 |
| Melting Point (Degree C) | 115 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|