| Primary information |
|---|
| ID | 20727 |
| Pubchem ID | NA |
| Name | Prostaglandin D2 |
| Description | Prostaglandin D2 (or PGD2) is a prostaglandin that is actively produced in various organs such as the brain; spleen; thymus; bone marrow; uterus; ovary; oviduct; testis; prostate and epididymis; and is involved in many physiological events. |
| Synonym | (5Z;13E)-(15S)-9alpha;15-Dihydroxy-11-oxoprosta-5;13-dienoateChEBI(5Z;13E;15S)-9alpha;15-Dihydroxy-11-oxoprosta-5;13-dienoateChEBI11-Dehydroprostaglandin F2-alphaChEBIPGD2ChEBI(5Z;13E)-(15S)-9a;15-Dih |
| Molecular Weight | 352.4651 |
| Formula | NA |
| IUPAC | (5Z)-7-[(1R;2R;5S)-5-hydroxy-2-[(1E;3S)-3-hydroxyoct-1-en-1-yl]-3-oxocyclopentyl]hept-5-enoic acid |
| SMILE | [H][C@](O)(CCCCC)C=C[C@@]1([H])C(=O)C[C@]([H])(O)[C@]1([H])CC=C/CCCC(O)=O |
| PDB ID | NA |
| KEGG | C00696 |
| HMDB ID | HMDB0001403 |
| Melting Point (Degree C) | 56 |
| Water Solubility | NA |
| Drugbank ID | DB02056 |
| Receptor | Q13258, Q9Y5Y4; P70263; Q9R261; Q9Z2J6 |
| Reference | HMDB
|