| Primary information |
|---|
| ID | 20725 |
| Pubchem ID | NA |
| Name | Lipoxin A4 |
| Description | Lipoxin A4 (LXA4) was first identified in 1984 by Serhan and colleagues as 5-lipoxygenase interaction product of activated leukocytes. Endogenous transcellular biosynthesis of LXA4 occurs via interaction of leukocytes with epithelium; endothelium or platelets. |
| Synonym | (5S;6R;15S)-Trihydroxy-7;9;13-trans-11-cis-eicosatetraenoic acidChEBI(5S;6R;7E;9E;11Z;13E;15S)-5;6;15-Trihydroxy-7;9;11;13-eicosatetraenoic acidChEBI(5S;6R;7E;9E;11Z;13E;15S)-5;6;15-Trihydroxyeicosa-7 |
| Molecular Weight | 352.4651 |
| Formula | NA |
| IUPAC | (5S;6R;7E;9E;11Z;13E;15S)-5;6;15-trihydroxyicosa-7;9;11;13-tetraenoic acid |
| SMILE | CCCCC[C@H](O)C=CC=C/C=C/C=C/[C@@H](O)[C@@H](O)CCCC(O)=O |
| PDB ID | NA |
| KEGG | C06314 |
| HMDB ID | HMDB0004385 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|