| Primary information |
|---|
| ID | 20724 |
| Pubchem ID | NA |
| Name | Leukotriene E4 |
| Description | Leukotriene E4 (LTE4) is a cysteinyl leukotriene. Cysteinyl leukotrienes (CysLTs) are a family of potent inflammatory mediators that appear to contribute to the pathophysiologic features of allergic rhinitis. Nasal blockage induced by CysLTs is mainly due to dilatation of nasal blood vessels; which |
| Synonym | (5S-(5R*;6S*(s*);7E;9E;11Z;14Z))-6-((2-amino-2-carboxyethyl)thio)-5-hydroxy-7;9;11;14-eicosatetraenoic acidChEBI(7E;9E;11Z;14Z)-(5S;6R)-6-(Cystein-S-yl)-5-hydroxyeicosa-7;9;11;14-tetraenoateChEBI(7E;9 |
| Molecular Weight | 439.61 |
| Formula | NA |
| IUPAC | (5S;6R;7E;9E;11Z;14Z)-6-{[(2R)-2-amino-2-carboxyethyl]sulfanyl}-5-hydroxyicosa-7;9;11;14-tetraenoic acid |
| SMILE | CCCCCC=C/CC=C/C=C/C=C/[C@@H](SC[C@H](N)C(O)=O)[C@@H](O)CCCC(O)=O |
| PDB ID | NA |
| KEGG | C05952 |
| HMDB ID | HMDB0002200 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|