| Primary information |
|---|
| ID | 20723 |
| Pubchem ID | NA |
| Name | Leukotriene D4 |
| Description | Leukotriene D4 (LTD4) is a cysteinyl leukotriene. Cysteinyl leukotrienes (CysLTs) are a family of potent inflammatory mediators that appear to contribute to the pathophysiologic features of allergic rhinitis. |
| Synonym | (R-(R*;s*-(e;e;Z;Z)))-N-(S-(1-(4-carboxy-1-hydroxybutyl)-2;4;6;9-pentadecatetraenyl)-L-cysteinyl)glycineChEBI5S-Hydroxy-6R-(S-cysteinylglycinyl)-7E;9E;11E;14Z-eicosatetraenoic acidChEBILTD4ChEBI5S-Hyd |
| Molecular Weight | 496.66 |
| Formula | NA |
| IUPAC | (5S;6R;7E;9E;11Z;14Z)-6-{[(2R)-2-amino-2-[(carboxymethyl)carbamoyl]ethyl]sulfanyl}-5-hydroxyicosa-7;9;11;14-tetraenoic acid |
| SMILE | CCCCCC=C/CC=C/C=C/C=C/[C@@H](SC[C@H](N)C(=O)NCC(O)=O)[C@@H](O)CCCC(O)=O |
| PDB ID | NA |
| KEGG | C05951 |
| HMDB ID | HMDB0003080 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | DB11858 |
| Receptor | NA |
| Reference | HMDB
|