| Primary information |
|---|
| ID | 20722 |
| Pubchem ID | NA |
| Name | Leukotriene C4 |
| Description | Leukotriene C4 (LTC4) is a cysteinyl leukotriene (CysLT); a family of potent inflammatory mediators. Eosinophils; one of the principal cell types recruited to and activated at sites of allergic inflammation; is capable of elaborating lipid mediators; including leukotrienes derived from the oxidative |
| Synonym | (R-(R*;s*-(e;e;Z;Z)))-N-(S-(1-(4-carboxy-1-hydroxybutyl)-2;4;6;9-pentadecatetraenyl)-N-L-gamma-glutamyl-L-cysteinyl)glycineChEBI5S;6R-LTC(Sub 4)ChEBI5S-Hydroxy;6R-(S-glutathionyl);7E;9E;11Z;14Z-eicosa |
| Molecular Weight | 625.774 |
| Formula | NA |
| IUPAC | (5S;6R;7E;9E;11Z;14Z)-6-{[(2R)-2-[(4S)-4-amino-4-carboxybutanamido]-2-[(carboxymethyl)carbamoyl]ethyl]sulfanyl}-5-hydroxyicosa-7;9;11;14-tetraenoic acid |
| SMILE | CCCCCC=C/CC=C/C=C/C=C/[C@@H](SC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O)[C@@H](O)CCCC(O)=O |
| PDB ID | NA |
| KEGG | C02166 |
| HMDB ID | HMDB0001198 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | DB08855 |
| Receptor | NA |
| Reference | HMDB
|