| Primary information |
|---|
| ID | 20719 |
| Pubchem ID | NA |
| Name | Leukotriene B4 ethanolamide |
| Description | Leukotriene B4 ethanolamide is a synthetic agonist of leukotriene B4 (LTB4); that interacts with both leukotriene B4 receptors and Vanilloid TRPV1 receptors. Leukotriene B4 is the major metabolite in neutrophil polymorphonuclear leukocytes. Leukotrienes are metabolites of arachidonic acid derived fr |
| Synonym | LTB4 Ethanol amide; N-(2-Hydroxyethyl)-5S;12R-dihydroxy-6Z;8E;10E;14Z-eicosatetraen-1-amide |
| Molecular Weight | 379.5335 |
| Formula | NA |
| IUPAC | (5S;6Z;8E;10E;12R;14Z)-5;12-dihydroxy-N-(2-hydroxyethyl)icosa-6;8;10;14-tetraenamide |
| SMILE | CCCCCC=C/C[C@@H](O)C=CC=CC=C/[C@@H](O)CCCC(=O)NCCO |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0002304 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|