| Primary information |
|---|
| ID | 20718 |
| Pubchem ID | NA |
| Name | Leukotriene B4 dimethylamide |
| Description | Leukotriene B4 dimethylamide is a derivative of Leukotriene B4 (LTB4) and was shown to inhibit neutrophil degranulation induced by LTB4. LTB4 is the major metabolite in neutrophil polymorphonuclear leukocytes. Leukotrienes are metabolites of arachidonic acid derived from the action of 5-LO (5-lipoxy |
| Synonym | LTB4 Dimethyl amide; LTB4-Dimethylamide; N;N-Dimethyl-5S;12R-dihydroxy-6Z;8E;10E;14Z-eicosatetraen-1-amide; [S-[R*;s*-(e;Z;e;Z)]]-5;12-dihydroxy-N;N-dimethyl-6;8;10;14-eicosatetraenamide; LTB4dMA; Leu |
| Molecular Weight | 363.5341 |
| Formula | NA |
| IUPAC | (5S;6Z;8E;10E;12R;14Z)-5;12-dihydroxy-N;N-dimethylicosa-6;8;10;14-tetraenamide |
| SMILE | CCCCCC=C/C[C@@H](O)C=CC=CC=C/[C@@H](O)CCCC(=O)N(C)C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0005085 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|